Products 2090414-76-7

CAS 2090414-76-7 is the registry number for 2-(3-Chloro-1h-1,2,4-triazol-1-yl)isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-chloro-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid (CAS 2090414-76-7) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 2-(3-chloro-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid. InChIKey: DVEFJLNQCXRVAH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN4O2
Molecular weight224.60 g/mol
IUPAC name2-(3-chloro-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid
InChIKeyDVEFJLNQCXRVAH-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1C(=O)O)N2C=NC(=N2)Cl

Computed by PubChem (NCBI)