CAS 2090414-76-7 is the registry number for 2-(3-Chloro-1h-1,2,4-triazol-1-yl)isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-chloro-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid (CAS 2090414-76-7) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 2-(3-chloro-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid. InChIKey: DVEFJLNQCXRVAH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 2-(3-chloro-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid |
| InChIKey | DVEFJLNQCXRVAH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)O)N2C=NC(=N2)Cl |
Computed by PubChem (NCBI)