CAS 1446507-37-4 appears in our catalog under these names: 6-(6-Chloropyridin-2-yl)-1,3,5-triazine-2,4(1H,3H)-dione, 97%, 6-(6-Chloropyridin-2-yl)-1,3,5-triazine-2,4(1H,3H)-dione, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
6-(6-chloro-2-pyridinyl)-1H-1,3,5-triazine-2,4-dione (CAS 1446507-37-4) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 6-(6-chloro-2-pyridinyl)-1H-1,3,5-triazine-2,4-dione. InChIKey: QIJLXYYNGZYYBE-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 6-(6-chloro-2-pyridinyl)-1H-1,3,5-triazine-2,4-dione |
| InChIKey | QIJLXYYNGZYYBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C2=NC(=O)NC(=O)N2 |
Computed by PubChem (NCBI)