CAS 1108659-32-0 appears in our catalog under these names: 2,4-Dichloro-7-methoxy-8-methylquinoline, 95%, 2,4-Dichloro-7-methoxy-8-methyl-quinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,4-dichloro-7-methoxy-8-methylquinoline (CAS 1108659-32-0) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 2,4-dichloro-7-methoxy-8-methylquinoline. InChIKey: LXMBJRUBTLFCFT-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2,4-dichloro-7-methoxy-8-methylquinoline |
| InChIKey | LXMBJRUBTLFCFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(C=C2Cl)Cl)OC |
Computed by PubChem (NCBI)