CAS 2768873-18-1 is the registry number for 2,4-Dichloro-7-methoxy-3-methylquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7-methoxy-3-methylquinoline (CAS 2768873-18-1) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 2,4-dichloro-7-methoxy-3-methylquinoline. InChIKey: NGFRWCWPSPTXOC-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2,4-dichloro-7-methoxy-3-methylquinoline |
| InChIKey | NGFRWCWPSPTXOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C(C=C2)OC)N=C1Cl)Cl |
Computed by PubChem (NCBI)