Products 948291-11-0
CAS 948291-11-0 is the registry number for 2-Chloro-3-(chloromethyl)-6-methoxyquinoline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-3-(chloromethyl)-6-methoxyquinoline (CAS 948291-11-0) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 2-chloro-3-(chloromethyl)-6-methoxyquinoline. InChIKey: HMIQFHGMCNXAPJ-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-chloro-3-(chloromethyl)-6-methoxyquinoline |
| InChIKey | HMIQFHGMCNXAPJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC(=C(N=C2C=C1)Cl)CCl |
Computed by PubChem (NCBI)