Products 70886-70-3
CAS 70886-70-3 is the registry number for 2-(Chloromethyl)-5-(4-chlorophenyl)-4-methyl-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5-(4-chlorophenyl)-4-methyl-1,3-oxazole (CAS 70886-70-3) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 2-(chloromethyl)-5-(4-chlorophenyl)-4-methyl-1,3-oxazole. InChIKey: RDYSXEWAVCFZBK-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(4-chlorophenyl)-4-methyl-1,3-oxazole |
| InChIKey | RDYSXEWAVCFZBK-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)CCl)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)