CAS 1643438-51-0 is the registry number for Amitifadine Lactone. Offered by: TRC. Available pack sizes: 25mg.
(1S,5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one (CAS 1643438-51-0) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: (1S,5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one. InChIKey: GHTDRYUZUUUQAU-HQJQHLMTSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | (1S,5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one |
| InChIKey | GHTDRYUZUUUQAU-HQJQHLMTSA-N |
| SMILES | C1[C@H]2[C@@]1(CNC2=O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)