CAS 24623-59-4 is the registry number for 3,8-Dichloro-2,5-dimethylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,8-dichloro-2,5-dimethylisoquinolin-1-one (CAS 24623-59-4) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 3,8-dichloro-2,5-dimethylisoquinolin-1-one. InChIKey: MVOLPGXQRXQESF-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 3,8-dichloro-2,5-dimethylisoquinolin-1-one |
| InChIKey | MVOLPGXQRXQESF-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(N(C(=O)C2=C(C=C1)Cl)C)Cl |
Computed by PubChem (NCBI)