Products 475481-96-0
CAS 475481-96-0 is the registry number for 4-(Chloromethyl)-2-(2-chlorophenyl)-5-methyloxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(chloromethyl)-2-(2-chlorophenyl)-5-methyl-1,3-oxazole (CAS 475481-96-0) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 4-(chloromethyl)-2-(2-chlorophenyl)-5-methyl-1,3-oxazole. InChIKey: WOYTZASJYGTKTB-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2-chlorophenyl)-5-methyl-1,3-oxazole |
| InChIKey | WOYTZASJYGTKTB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2Cl)CCl |
Computed by PubChem (NCBI)