CAS 70996-53-1 appears in our catalog under these names: 2-(1-Chloroethyl)-5-(4-chlorophenyl)-1,3-oxazole, 95%, 2-(1-Chloroethyl)-5-(4-chlorophenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(1-chloroethyl)-5-(4-chlorophenyl)-1,3-oxazole (CAS 70996-53-1) is a chemical compound with the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. IUPAC name: 2-(1-chloroethyl)-5-(4-chlorophenyl)-1,3-oxazole. InChIKey: XKCNPRPSWNAOPX-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-(1-chloroethyl)-5-(4-chlorophenyl)-1,3-oxazole |
| InChIKey | XKCNPRPSWNAOPX-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(O1)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)