CAS 92541-43-0 appears in our catalog under these names: cis-2-(Methoxycarbonyl)cyclopentanecarboxylic acid, 1,2-Cyclopentanedicarboxylic acid, 1-methyl ester, (1R,2S)-rel-, 97%, 97%, cis-2-(Methoxycarbonyl)cyclopentanecarboxylic acid, 98.0%, cis-2-Carbomethoxycyclopentane-1-carboxylic acid, 98%, cis-2-(Methoxycarbonyl)cyclopentanecarboxylic acid, 97%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 500 mg, 250 mg, 100 mg, 1 g.
Cis-(1R,2S)-2-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 92541-43-0) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: KYGFHAUBFNTXFK-RITPCOANSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | KYGFHAUBFNTXFK-RITPCOANSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)