Products 1112044-47-9
CAS 1112044-47-9 appears in our catalog under these names: 2，2–difluoro–2–(4–(trifluoromethoxy)phenyl)acetic acid, 2,2-difluoro-2-[4-(trifluoromethoxy)phenyl]acetic acid, 94%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 50mg, 10mg, 250mg, 5g.
2,2-difluoro-2-[4-(trifluoromethoxy)phenyl]acetic acid (CAS 1112044-47-9) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 2,2-difluoro-2-[4-(trifluoromethoxy)phenyl]acetic acid. InChIKey: KHUVKUWYAVSZQD-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2,2-difluoro-2-[4-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | KHUVKUWYAVSZQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)OC(F)(F)F |
Computed by PubChem (NCBI)