CAS 801303-45-7 appears in our catalog under these names: 3,5-Difluoro-4-(2,2,2-trifluoroethoxy)benzoic acid, 95%, 3,5–Difluoro–4–(2,2,2–trifluoroethoxy)–Benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
3,5-difluoro-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 801303-45-7) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 3,5-difluoro-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: MXWUCBHSUUSIDV-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 3,5-difluoro-4-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | MXWUCBHSUUSIDV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCC(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)