Products 2593401-23-9

CAS 2593401-23-9 is the registry number for 3-(Difluoromethyl)-5-(trifluoromethoxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(difluoromethyl)-5-(trifluoromethoxy)benzoic acid (CAS 2593401-23-9) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 3-(difluoromethyl)-5-(trifluoromethoxy)benzoic acid. InChIKey: NIHDTSSJAPCERW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F5O3
Molecular weight256.13 g/mol
IUPAC name3-(difluoromethyl)-5-(trifluoromethoxy)benzoic acid
InChIKeyNIHDTSSJAPCERW-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)OC(F)(F)F)C(F)F

Computed by PubChem (NCBI)