Products 1133116-03-6
CAS 1133116-03-6 is the registry number for 2,2-Difluoro-2-(2-(trifluoromethoxy)phenyl)acetic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetic acid (CAS 1133116-03-6) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetic acid. InChIKey: JIKMKBRSFLYDPZ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | JIKMKBRSFLYDPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)(F)F)OC(F)(F)F |
Computed by PubChem (NCBI)