Products 1133116-03-6

CAS 1133116-03-6 appears in our catalog under these names: 2,2-Difluoro-2-(2-(trifluoromethoxy)phenyl)acetic acid, 98%, 2,2-Difluoro-2-(2-(trifluoromethoxy)phenyl)acetic acid 98%, 2,2-Difluoro-2-(2-(trifluoromethoxy)phenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetic acid (CAS 1133116-03-6) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetic acid. InChIKey: JIKMKBRSFLYDPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F5O3
Molecular weight256.13 g/mol
IUPAC name2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetic acid
InChIKeyJIKMKBRSFLYDPZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(C(=O)O)(F)F)OC(F)(F)F

Computed by PubChem (NCBI)