Products 79865-59-1
CAS 79865-59-1 appears in our catalog under these names: 4-(1,1,2,2,2-Pentafluoroethoxy)benzoic acid, 95%, 4-(Pentafluoroethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
4-(1,1,2,2,2-pentafluoroethoxy)benzoic acid (CAS 79865-59-1) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 4-(1,1,2,2,2-pentafluoroethoxy)benzoic acid. InChIKey: SUTOUQPTCJCIKM-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentafluoroethoxy)benzoic acid |
| InChIKey | SUTOUQPTCJCIKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)