Products 1500039-10-0
CAS 1500039-10-0 is the registry number for 2-Hydroxy-3-(perfluorophenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid (CAS 1500039-10-0) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 2-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid. InChIKey: LTHHFXRAMIWXSR-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| InChIKey | LTHHFXRAMIWXSR-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)O |
Computed by PubChem (NCBI)