Products 1541345-81-6

CAS 1541345-81-6 is the registry number for 2-(3,5-Difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3,5-difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid (CAS 1541345-81-6) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid. InChIKey: CXBMAUJXZDECTD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F5O3
Molecular weight256.13 g/mol
IUPAC name2-(3,5-difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid
InChIKeyCXBMAUJXZDECTD-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1F)F)C(C(=O)O)(C(F)(F)F)O

Computed by PubChem (NCBI)