CAS 1541345-81-6 is the registry number for 2-(3,5-Difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid (CAS 1541345-81-6) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid. InChIKey: CXBMAUJXZDECTD-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-3,3,3-trifluoro-2-hydroxypropanoic acid |
| InChIKey | CXBMAUJXZDECTD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(C(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)