CAS 111252-36-9 appears in our catalog under these names: N-Aminopiperidine hydrochloride, 95%, (E)-3-(5-Acetylfuran-2-yl)acrylic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 10g, 5g, on request.
3-(5-acetylfuran-2-yl)prop-2-enoic acid (CAS 111252-36-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-(5-acetylfuran-2-yl)prop-2-enoic acid. InChIKey: HPGYWVBLRIJUIB-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-(5-acetylfuran-2-yl)prop-2-enoic acid |
| InChIKey | HPGYWVBLRIJUIB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(O1)C=CC(=O)O |
Computed by PubChem (NCBI)