CAS 111829-72-2 appears in our catalog under these names: 4–Bromo–2,6–dichlorobenzaldehyde, 4-Bromo-2,6-dichlorobenzaldehyde 98%, 4-Bromo-2,6-dichlorobenzaldehyde, 98%, 98%, 4-Bromo-2,6-dichlorobenzaldehyde, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 100g, 50g.
4-bromo-2,6-dichlorobenzaldehyde (CAS 111829-72-2) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 4-bromo-2,6-dichlorobenzaldehyde. InChIKey: FXYQBYXIEVCPHZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 4-bromo-2,6-dichlorobenzaldehyde |
| InChIKey | FXYQBYXIEVCPHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)Br |
Computed by PubChem (NCBI)