CAS 1119450-79-1 is the registry number for 3-[5-(Phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde (CAS 1119450-79-1) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde. InChIKey: LYGAWYUALHLDSK-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde |
| InChIKey | LYGAWYUALHLDSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NC(=NO2)C3=CC=CC(=C3)C=O |
Computed by PubChem (NCBI)