CAS 420846-72-6 appears in our catalog under these names: 3-((4-Oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic acid, 95%, Olaparib Impurity 20, 3–((4–oxo–3,4–dihydrophthalazin–1–yl)methyl)benzoicacid, 3-[(3,4-Dihydro-4-oxo-1-phthalazinyl)methyl]benzoic acid, 98%, 98%, Olaparib impurity 22, 98.0%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, on request, 10g, 5g, 100mg, 250 mg, 1 g.
3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 420846-72-6) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: LOEQJTGFMWZFBM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid |
| InChIKey | LOEQJTGFMWZFBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)