Products 924020-62-2
CAS 924020-62-2 appears in our catalog under these names: 4-(5-(2-Methylphenyl)-1,3,4-oxadiazol-2-yl)benzoic acid, 4-[5-(2-Methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid, 95%, 4-(5-(2-Methylphenyl)-1,3,4-oxadiazol-2-yl)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 10g, 250mg, 100mg, 1g.
4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid (CAS 924020-62-2) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid. InChIKey: KURXZGZYBDHSQZ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| InChIKey | KURXZGZYBDHSQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)