CAS 1239769-54-0 is the registry number for [3-(2-Naphthyl)-6-oxopyridazin-1(6h)-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetic acid (CAS 1239769-54-0) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetic acid. InChIKey: SOWAWMMWUICAHE-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetic acid |
| InChIKey | SOWAWMMWUICAHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NN(C(=O)C=C3)CC(=O)O |
Computed by PubChem (NCBI)