CAS 345228-18-4 appears in our catalog under these names: 3-Phenyl-4-phthalazinone-1-acetic acid, (4-Oxo-3-phenyl-3,4-dihydrophthalazin-1-yl)acetic acid, 98%, 2-(4-Oxo-3-phenyl-3,4-dihydrophthalazin-1-yl)acetic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1000mg, 2000mg, 5000mg, 5g, 10g, 250mg, 1g.
2-(4-oxo-3-phenylphthalazin-1-yl)acetic acid (CAS 345228-18-4) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 2-(4-oxo-3-phenylphthalazin-1-yl)acetic acid. InChIKey: UMXAVNXVERFWSD-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-(4-oxo-3-phenylphthalazin-1-yl)acetic acid |
| InChIKey | UMXAVNXVERFWSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C(=N2)CC(=O)O |
Computed by PubChem (NCBI)