Products 790681-49-1
CAS 790681-49-1 is the registry number for 4-[(1,3-Dioxoisoindol-2-yl)methyl]benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (CAS 790681-49-1) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide. InChIKey: JBJSDZAIGWLMJA-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| InChIKey | JBJSDZAIGWLMJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC=C(C=C3)C(=O)N |
Computed by PubChem (NCBI)