Products 1269527-71-0

CAS 1269527-71-0 is the registry number for [3-(1-Naphthyl)-6-oxopyridazin-1(6h)-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-naphthalen-1-yl-6-oxopyridazin-1-yl)acetic acid (CAS 1269527-71-0) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 2-(3-naphthalen-1-yl-6-oxopyridazin-1-yl)acetic acid. InChIKey: NUXDIHHWPHFCEI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12N2O3
Molecular weight280.28 g/mol
IUPAC name2-(3-naphthalen-1-yl-6-oxopyridazin-1-yl)acetic acid
InChIKeyNUXDIHHWPHFCEI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2C3=NN(C(=O)C=C3)CC(=O)O

Computed by PubChem (NCBI)