CAS 540495-74-7 appears in our catalog under these names: 2-[(4-Oxo-3,4-dihydroquinazolin-2-yl)methyl]benzoic acid, 95%, 2-((4-Oxo-3,4-dihydroquinazolin-2-yl)methyl)benzoic acid, 95%, 2-((4-Oxo-3,4-dihydroquinazolin-2-yl)methyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoic acid (CAS 540495-74-7) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoic acid. InChIKey: HYGGQEMOVYEUKG-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoic acid |
| InChIKey | HYGGQEMOVYEUKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC3=CC=CC=C3C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)