Products 1134328-15-6
CAS 1134328-15-6 appears in our catalog under these names: 5-Bromo-6-methoxy-1H-indazole-3-carboxylic acid methyl ester, 95+%, Methyl 5-bromo-6-methoxy-1H-indazole-3-carboxylate, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
Methyl 5-bromo-6-methoxy-1H-indazole-3-carboxylate (CAS 1134328-15-6) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: methyl 5-bromo-6-methoxy-1H-indazole-3-carboxylate. InChIKey: INTKEYLIECPVQT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | methyl 5-bromo-6-methoxy-1H-indazole-3-carboxylate |
| InChIKey | INTKEYLIECPVQT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NN=C2C(=O)OC)Br |
Computed by PubChem (NCBI)