CAS 1134692-74-2 appears in our catalog under these names: 3-(3,4-Difluorophenyl)-1-methyl-1(h)-pyrazole-5-carboxylic acid, 96%, 3-(3,4-difluorophenyl)-1-methyl-1{H}-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-(3,4-difluorophenyl)-1-methylpyrazole-5-carboxylic acid (CAS 1134692-74-2) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 3-(3,4-difluorophenyl)-1-methylpyrazole-5-carboxylic acid. InChIKey: FGJAILOFVCOWJI-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)-1-methylpyrazole-5-carboxylic acid |
| InChIKey | FGJAILOFVCOWJI-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)