Products 1271723-46-6
CAS 1271723-46-6 is the registry number for 2-(2,4-Difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid (CAS 1271723-46-6) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid. InChIKey: AXSNGLYOBWNNPT-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid |
| InChIKey | AXSNGLYOBWNNPT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)