Products 1152508-27-4
CAS 1152508-27-4 appears in our catalog under these names: 3-(2,4-Difluorophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 95%, 3-(2,4-Difluorophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(2,4-difluorophenyl)-1-methylpyrazole-4-carboxylic acid (CAS 1152508-27-4) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: VGUNYHHEBPOGFC-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-1-methylpyrazole-4-carboxylic acid |
| InChIKey | VGUNYHHEBPOGFC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)