Products 187999-20-8
CAS 187999-20-8 appears in our catalog under these names: 1-(2,4-Difluorophenyl)-5-methyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(2,4-Difluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylic acid (CAS 187999-20-8) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: RJBXTZNSOMPKAC-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | RJBXTZNSOMPKAC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)