Products 1275345-09-9
CAS 1275345-09-9 is the registry number for 2-(2,5-Difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid (CAS 1275345-09-9) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid. InChIKey: ZDTQHKGEDSCHQM-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid |
| InChIKey | ZDTQHKGEDSCHQM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)