Products 1972201-13-0

CAS 1972201-13-0 is the registry number for 1-(3,4-Difluorobenzyl)-1h-imidazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(3,4-difluorophenyl)methyl]imidazole-4-carboxylic acid (CAS 1972201-13-0) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]imidazole-4-carboxylic acid. InChIKey: PESLBRGDNPTZHE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8F2N2O2
Molecular weight238.19 g/mol
IUPAC name1-[(3,4-difluorophenyl)methyl]imidazole-4-carboxylic acid
InChIKeyPESLBRGDNPTZHE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CN2C=C(N=C2)C(=O)O)F)F

Computed by PubChem (NCBI)