CAS 1972201-13-0 is the registry number for 1-(3,4-Difluorobenzyl)-1h-imidazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(3,4-difluorophenyl)methyl]imidazole-4-carboxylic acid (CAS 1972201-13-0) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]imidazole-4-carboxylic acid. InChIKey: PESLBRGDNPTZHE-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 1-[(3,4-difluorophenyl)methyl]imidazole-4-carboxylic acid |
| InChIKey | PESLBRGDNPTZHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN2C=C(N=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)