Products 288252-20-0
CAS 288252-20-0 appears in our catalog under these names: 1-(3,4-Difluorophenyl)-5-methyl-1h-pyrazole-4-carboxylic acid, 95%, Piraxostat Impurity 2. Offered by: Combi-blocks, Hubei YoungXin. Available pack sizes: 10g, 5g, 250mg, 1g, 10mg, 25mg, 50mg, 100mg.
1-(3,4-difluorophenyl)-5-methylpyrazole-4-carboxylic acid (CAS 288252-20-0) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 1-(3,4-difluorophenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: ZPUYQNXDSDQEHK-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | ZPUYQNXDSDQEHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)