Products 1305515-19-8
CAS 1305515-19-8 is the registry number for 2-(3,4-Difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid (CAS 1305515-19-8) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid. InChIKey: NRXZRZLZMSTRAZ-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylic acid |
| InChIKey | NRXZRZLZMSTRAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N1)C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)