CAS 1135283-05-4 is the registry number for 2,2,2-Trichloro-1-[4-(1-hydroxypropyl)-1h-pyrrol-2-yl]-1-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2,2-trichloro-1-[4-(1-hydroxypropyl)-1H-pyrrol-2-yl]ethanone (CAS 1135283-05-4) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: 2,2,2-trichloro-1-[4-(1-hydroxypropyl)-1H-pyrrol-2-yl]ethanone. InChIKey: AWXKHWPBFVMHKO-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | 2,2,2-trichloro-1-[4-(1-hydroxypropyl)-1H-pyrrol-2-yl]ethanone |
| InChIKey | AWXKHWPBFVMHKO-UHFFFAOYSA-N |
| SMILES | CCC(C1=CNC(=C1)C(=O)C(Cl)(Cl)Cl)O |
Computed by PubChem (NCBI)