Products 2097958-05-7
CAS 2097958-05-7 appears in our catalog under these names: (R)-3-Amino-3-(3,4-dichlorophenyl)propanoic acid hydrochloride, 95%, (R)–3–Amino–3–(3，4–dichlorophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(3R)-3-amino-3-(3,4-dichlorophenyl)propanoic acid;hydrochloride (CAS 2097958-05-7) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: (3R)-3-amino-3-(3,4-dichlorophenyl)propanoic acid;hydrochloride. InChIKey: MXVMZTUYNYCRDW-DDWIOCJRSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | (3R)-3-amino-3-(3,4-dichlorophenyl)propanoic acid;hydrochloride |
| InChIKey | MXVMZTUYNYCRDW-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](CC(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)