Products 1384264-44-1
CAS 1384264-44-1 is the registry number for Ethyl 5-chloro-6-(chloromethyl)nicotinate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 5-chloro-6-(chloromethyl)pyridine-3-carboxylate;hydrochloride (CAS 1384264-44-1) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: ethyl 5-chloro-6-(chloromethyl)pyridine-3-carboxylate;hydrochloride. InChIKey: HGZYLBLMEKKUGT-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | ethyl 5-chloro-6-(chloromethyl)pyridine-3-carboxylate;hydrochloride |
| InChIKey | HGZYLBLMEKKUGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)CCl)Cl.Cl |
Computed by PubChem (NCBI)