CAS 128833-97-6 is the registry number for 2-Amino-3-(3,5-dichlorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-3-(3,5-dichlorophenyl)propanoic acid;hydrochloride (CAS 128833-97-6) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: 2-amino-3-(3,5-dichlorophenyl)propanoic acid;hydrochloride. InChIKey: VAISQIUJIKNCPW-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | 2-amino-3-(3,5-dichlorophenyl)propanoic acid;hydrochloride |
| InChIKey | VAISQIUJIKNCPW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)