Products 128833-97-6

CAS 128833-97-6 is the registry number for 2-Amino-3-(3,5-dichlorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-amino-3-(3,5-dichlorophenyl)propanoic acid;hydrochloride (CAS 128833-97-6) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: 2-amino-3-(3,5-dichlorophenyl)propanoic acid;hydrochloride. InChIKey: VAISQIUJIKNCPW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Cl3NO2
Molecular weight270.5 g/mol
IUPAC name2-amino-3-(3,5-dichlorophenyl)propanoic acid;hydrochloride
InChIKeyVAISQIUJIKNCPW-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)CC(C(=O)O)N.Cl

Computed by PubChem (NCBI)