Products 1423023-99-7
CAS 1423023-99-7 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-2-(methylamino)acetic acid hydrochloride, 95%, 2-(3,5-Dichlorophenyl)-2-(methylamino)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(3,5-dichlorophenyl)-2-(methylamino)acetic acid;hydrochloride (CAS 1423023-99-7) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2-(methylamino)acetic acid;hydrochloride. InChIKey: IINNBWSHLLQYFH-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2-(methylamino)acetic acid;hydrochloride |
| InChIKey | IINNBWSHLLQYFH-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC(=CC(=C1)Cl)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)