CAS 1803566-54-2 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)-2-(methylamino)acetic acid hydrochloride, 2-(2,6-Dichlorophenyl)-2-(methylamino)acetic acid hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
2-(2,6-dichlorophenyl)-2-(methylamino)acetic acid;hydrochloride (CAS 1803566-54-2) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-2-(methylamino)acetic acid;hydrochloride. InChIKey: PPPLRMNOTNTUKX-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-2-(methylamino)acetic acid;hydrochloride |
| InChIKey | PPPLRMNOTNTUKX-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C=CC=C1Cl)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)