Products 2322533-51-5
CAS 2322533-51-5 is the registry number for (S)-2-Amino-3-(2,6-dichlorophenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid;hydrochloride (CAS 2322533-51-5) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: (2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid;hydrochloride. InChIKey: SSTFPAMFDCZJDF-QRPNPIFTSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid;hydrochloride |
| InChIKey | SSTFPAMFDCZJDF-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C[C@@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)