CAS 499794-65-9 is the registry number for (R)-3-Amino-3-(2,4-dichloro-phenyl)-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R)-3-amino-3-(2,4-dichlorophenyl)propanoic acid;hydrochloride (CAS 499794-65-9) is a chemical compound with the molecular formula C9H10Cl3NO2 and a molecular weight of 270.5 g/mol. IUPAC name: (3R)-3-amino-3-(2,4-dichlorophenyl)propanoic acid;hydrochloride. InChIKey: SBVHKAWQDJPAQN-DDWIOCJRSA-N.
| Molecular formula | C9H10Cl3NO2 |
|---|---|
| Molecular weight | 270.5 g/mol |
| IUPAC name | (3R)-3-amino-3-(2,4-dichlorophenyl)propanoic acid;hydrochloride |
| InChIKey | SBVHKAWQDJPAQN-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)