CAS 1135872-19-3 is the registry number for 2-(8-Oxo-5,6,7,8-tetrahydronaphthalen-2-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 1135872-19-3) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 2-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: MEBSABYSLKYSDQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 2-(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | MEBSABYSLKYSDQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C3=NC(=CS3)C(=O)O)C(=O)C1 |
Computed by PubChem (NCBI)