CAS 1889802-11-2 appears in our catalog under these names: 5–(5–Methoxybenzo(b)thiophen–2–yl)–1H–pyrrole–2–carboxylic acid, 5-(5-Methoxybenzo[b]thiophen-2-yl)-1h-pyrrole-2-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
5-(5-methoxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid (CAS 1889802-11-2) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 5-(5-methoxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid. InChIKey: GSLAAMJEQPCAQD-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 5-(5-methoxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | GSLAAMJEQPCAQD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=C2)C3=CC=C(N3)C(=O)O |
Computed by PubChem (NCBI)