CAS 1881331-22-1 is the registry number for 1-(Benzenesulfonyl)-1H-indol-3-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
1-(benzenesulfonyl)indol-3-ol (CAS 1881331-22-1) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 1-(benzenesulfonyl)indol-3-ol. InChIKey: BGYSZIIKXIPGIE-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indol-3-ol |
| InChIKey | BGYSZIIKXIPGIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)O |
Computed by PubChem (NCBI)