CAS 2288020-80-2 is the registry number for 5-(Methylsulfonyl)-2-phenylbenzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
5-methylsulfonyl-2-phenyl-1,3-benzoxazole (CAS 2288020-80-2) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 5-methylsulfonyl-2-phenyl-1,3-benzoxazole. InChIKey: OLUXUIDUFBBAGY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 5-methylsulfonyl-2-phenyl-1,3-benzoxazole |
| InChIKey | OLUXUIDUFBBAGY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)OC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)