CAS 270262-89-0 appears in our catalog under these names: 4-[(4-Methylphenyl)thio]-3-nitrobenzaldehyde, 95%, 4-((4-Methylphenyl)thio)-3-nitrobenzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g.
4-(4-methylphenyl)sulfanyl-3-nitrobenzaldehyde (CAS 270262-89-0) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 4-(4-methylphenyl)sulfanyl-3-nitrobenzaldehyde. InChIKey: PISSEQSHPLGJCY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfanyl-3-nitrobenzaldehyde |
| InChIKey | PISSEQSHPLGJCY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=C(C=C(C=C2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)